C17H16Cl2N2O2 — CID 110535794
2-(3,5-dichloro-2,4-dimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole (PubChem CID 110535794) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is 2-(3,5-dichloro-2,4-dimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-(3,5-dichloro-2,4-dimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 110535794 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-(3,5-dichloro-2,4-dimethoxyphenyl)-5,6-dimethyl-1H-benzimidazole |
| SMILES | COc1c(Cl)cc(-c2nc3cc(C)c(C)cc3[nH]2)c(OC)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-8-5-12-13(6-9(8)2)21-17(20-12)10-7-11(18)16(23-4)14(19)15(10)22-3/h5-7H,1-4H3,(H,20,21) |
| InChIKey | PWLXIIVNCAPDMV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |