C15H22O2 — CID 11053586
7-propan-2-yl-2-propyl-2,6,7,8-tetrahydrochromen-5-one (PubChem CID 11053586) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 7-propan-2-yl-2-propyl-2,6,7,8-tetrahydrochromen-5-one.
| Compound Name | 7-propan-2-yl-2-propyl-2,6,7,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 11053586 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 7-propan-2-yl-2-propyl-2,6,7,8-tetrahydrochromen-5-one |
| SMILES | CCCC1C=CC2=C(CC(C(C)C)CC2=O)O1 |
| InChI | InChI=1S/C15H22O2/c1-4-5-12-6-7-13-14(16)8-11(10(2)3)9-15(13)17-12/h6-7,10-12H,4-5,8-9H2,1-3H3 |
| InChIKey | PJYQDSWBGXMXKS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |