About 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole
2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole (PubChem CID 110536356) has the molecular formula C19H22N2O4
and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole |
| PubChem CID | 110536356 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole |
| SMILES | CCOc1ccc(-c2nc3cc(OC)c(OC)cc3[nH]2)c(OCC)c1 |
| InChI | InChI=1S/C19H22N2O4/c1-5-24-12-7-8-13(16(9-12)25-6-2)19-20-14-10-17(22-3)18(23-4)11-15(14)21-19/h7-11H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | VSMRLYHSTNWXTH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole?
The IUPAC name of 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole (CID 110536356) is 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole.
What is the SMILES notation for 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole?
The canonical SMILES for 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole is CCOc1ccc(-c2nc3cc(OC)c(OC)cc3[nH]2)c(OCC)c1.
What is the InChIKey of 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole?
The InChIKey is VSMRLYHSTNWXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O4/c1-5-24-12-7-8-13(16(9-12)25-6-2)19-20-14-10-17(22-3)18(23-4)11-15(14)21-19/h7-11H,5-6H2,1-4H3,(H,20,21).
What are the key properties of 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole?
2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole has a molecular weight of 342.40 g/mol, XLogP of 4.04, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diethoxyphenyl)-5,6-dimethoxy-1H-benzimidazole is sourced from PubChem (CID 110536356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).