C13H20O4 — CID 11053768
(1S,2S,6S,7S,10R)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-8-one (PubChem CID 11053768) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1S,2S,6S,7S,10R)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-8-one.
| Compound Name | (1S,2S,6S,7S,10R)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-8-one |
|---|---|
| PubChem CID | 11053768 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (1S,2S,6S,7S,10R)-2,4,4,7,10-pentamethyl-3,5,11-trioxatricyclo[5.3.1.02,6]undecan-8-one |
| SMILES | C[C@@H]1CC(=O)[C@@]2(C)O[C@@H]1[C@]1(C)OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H20O4/c1-7-6-8(14)12(4)10-13(5,9(7)15-12)17-11(2,3)16-10/h7,9-10H,6H2,1-5H3/t7-,9+,10-,12-,13+/m1/s1 |
| InChIKey | IGTBNYHTUUTVIV-QDQFZDOBSA-N |
| XLogP | 1.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |