About (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene
(2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene (PubChem CID 11053811) has the molecular formula C10H5F3N2O2
and a molecular weight of 242.16 g/mol. Its IUPAC name is (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene.
Molecular Properties
| Compound Name | (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene |
| PubChem CID | 11053811 |
| Molecular Formula | C10H5F3N2O2 |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene |
| SMILES | O=C=NC(N=C=O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H5F3N2O2/c11-10(12,13)9(14-6-16,15-7-17)8-4-2-1-3-5-8/h1-5H |
| InChIKey | LYXPBRXCRMSURP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene?
The IUPAC name of (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene (CID 11053811) is (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene.
What is the SMILES notation for (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene?
The canonical SMILES for (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene is O=C=NC(N=C=O)(c1ccccc1)C(F)(F)F.
What is the InChIKey of (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene?
The InChIKey is LYXPBRXCRMSURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2O2/c11-10(12,13)9(14-6-16,15-7-17)8-4-2-1-3-5-8/h1-5H.
What are the key properties of (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene?
(2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene has a molecular weight of 242.16 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trifluoro-1,1-diisocyanatoethyl)benzene is sourced from PubChem (CID 11053811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).