About 8-carboxyoxyundecanoic acid
8-carboxyoxyundecanoic acid (PubChem CID 11053939) has the molecular formula C12H22O5
and a molecular weight of 246.30 g/mol. Its IUPAC name is 8-carboxyoxyundecanoic acid.
Molecular Properties
| Compound Name | 8-carboxyoxyundecanoic acid |
| PubChem CID | 11053939 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 8-carboxyoxyundecanoic acid |
| SMILES | CCCC(CCCCCCC(=O)O)OC(=O)O |
| InChI | InChI=1S/C12H22O5/c1-2-7-10(17-12(15)16)8-5-3-4-6-9-11(13)14/h10H,2-9H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | BJQKBCXLCSJGEG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-carboxyoxyundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-carboxyoxyundecanoic acid?
The IUPAC name of 8-carboxyoxyundecanoic acid (CID 11053939) is 8-carboxyoxyundecanoic acid.
What is the SMILES notation for 8-carboxyoxyundecanoic acid?
The canonical SMILES for 8-carboxyoxyundecanoic acid is CCCC(CCCCCCC(=O)O)OC(=O)O.
What is the InChIKey of 8-carboxyoxyundecanoic acid?
The InChIKey is BJQKBCXLCSJGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O5/c1-2-7-10(17-12(15)16)8-5-3-4-6-9-11(13)14/h10H,2-9H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 8-carboxyoxyundecanoic acid?
8-carboxyoxyundecanoic acid has a molecular weight of 246.30 g/mol, XLogP of 3.27, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-carboxyoxyundecanoic acid is sourced from PubChem (CID 11053939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).