C14H18O4 — CID 11054062
(1S,4S,8S,12S)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecane-3,5,7-trione (PubChem CID 11054062) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1S,4S,8S,12S)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecane-3,5,7-trione.
| Compound Name | (1S,4S,8S,12S)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecane-3,5,7-trione |
|---|---|
| PubChem CID | 11054062 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1S,4S,8S,12S)-9,9,12-trimethyl-2-oxatricyclo[6.3.1.04,12]dodecane-3,5,7-trione |
| SMILES | CC1(C)CC[C@@H]2OC(=O)[C@@H]3C(=O)CC(=O)[C@@H]1[C@@]32C |
| InChI | InChI=1S/C14H18O4/c1-13(2)5-4-9-14(3)10(12(17)18-9)7(15)6-8(16)11(13)14/h9-11H,4-6H2,1-3H3/t9-,10-,11-,14+/m0/s1 |
| InChIKey | YZXOHPFZOVFJGF-AYGWYOGXSA-N |
| XLogP | 1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|