C20H16N2O7S — CID 110541047
1-(1,3-benzodioxol-5-ylmethyl)-3-(2-hydroxyethylsulfanyl)-4-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 110541047) has the molecular formula C20H16N2O7S and a molecular weight of 428.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-hydroxyethylsulfanyl)-4-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-hydroxyethylsulfanyl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110541047 |
| Molecular Formula | C20H16N2O7S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-hydroxyethylsulfanyl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(c2ccc([N+](=O)[O-])cc2)C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H16N2O7S/c23-7-8-30-18-17(13-2-4-14(5-3-13)22(26)27)19(24)21(20(18)25)10-12-1-6-15-16(9-12)29-11-28-15/h1-6,9,23H,7-8,10-11H2 |
| InChIKey | ZGMJGZMYFRVDBD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|