C18H21N — CID 11054109
N-(3-methylbutyl)-1,1-diphenylmethanimine (PubChem CID 11054109) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(3-methylbutyl)-1,1-diphenylmethanimine.
| Compound Name | N-(3-methylbutyl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11054109 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-(3-methylbutyl)-1,1-diphenylmethanimine |
| SMILES | CC(C)CCN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-15(2)13-14-19-18(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | AKRNRYUJGSFAAF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|