C20H25N3O5 — CID 110541603
3-(4-nitrophenyl)-1-(3-propan-2-yloxypropyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione (PubChem CID 110541603) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-1-(3-propan-2-yloxypropyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione.
| Compound Name | 3-(4-nitrophenyl)-1-(3-propan-2-yloxypropyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110541603 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-(4-nitrophenyl)-1-(3-propan-2-yloxypropyl)-4-pyrrolidin-1-ylpyrrole-2,5-dione |
| SMILES | CC(C)OCCCN1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C(N2CCCC2)C1=O |
| InChI | InChI=1S/C20H25N3O5/c1-14(2)28-13-5-12-22-19(24)17(15-6-8-16(9-7-15)23(26)27)18(20(22)25)21-10-3-4-11-21/h6-9,14H,3-5,10-13H2,1-2H3 |
| InChIKey | UPMGRMUGWXTDDC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|