C26H21F2N3O2 — CID 110544646
1,3-bis(4-fluorophenyl)-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110544646) has the molecular formula C26H21F2N3O2 and a molecular weight of 445.47 g/mol. Its IUPAC name is 1,3-bis(4-fluorophenyl)-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1,3-bis(4-fluorophenyl)-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110544646 |
| Molecular Formula | C26H21F2N3O2 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1,3-bis(4-fluorophenyl)-4-(4-phenylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)=C(N2CCN(c3ccccc3)CC2)C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21F2N3O2/c27-19-8-6-18(7-9-19)23-24(26(33)31(25(23)32)22-12-10-20(28)11-13-22)30-16-14-29(15-17-30)21-4-2-1-3-5-21/h1-13H,14-17H2 |
| InChIKey | JXJFIBIQRHVCFH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|