About 1,1-dimethyl-2,5-diphenylsilole
1,1-dimethyl-2,5-diphenylsilole (PubChem CID 11054501) has the molecular formula C18H18Si
and a molecular weight of 262.43 g/mol. Its IUPAC name is 1,1-dimethyl-2,5-diphenylsilole.
Molecular Properties
| Compound Name | 1,1-dimethyl-2,5-diphenylsilole |
| PubChem CID | 11054501 |
| Molecular Formula | C18H18Si |
| Molecular Weight | 262.43 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,1-dimethyl-2,5-diphenylsilole |
| SMILES | C[Si]1(C)C(c2ccccc2)=CC=C1c1ccccc1 |
| InChI | InChI=1S/C18H18Si/c1-19(2)17(15-9-5-3-6-10-15)13-14-18(19)16-11-7-4-8-12-16/h3-14H,1-2H3 |
| InChIKey | YCBUIVXZVYHASK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethyl-2,5-diphenylsilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-2,5-diphenylsilole?
The IUPAC name of 1,1-dimethyl-2,5-diphenylsilole (CID 11054501) is 1,1-dimethyl-2,5-diphenylsilole.
What is the SMILES notation for 1,1-dimethyl-2,5-diphenylsilole?
The canonical SMILES for 1,1-dimethyl-2,5-diphenylsilole is C[Si]1(C)C(c2ccccc2)=CC=C1c1ccccc1.
What is the InChIKey of 1,1-dimethyl-2,5-diphenylsilole?
The InChIKey is YCBUIVXZVYHASK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Si/c1-19(2)17(15-9-5-3-6-10-15)13-14-18(19)16-11-7-4-8-12-16/h3-14H,1-2H3.
What are the key properties of 1,1-dimethyl-2,5-diphenylsilole?
1,1-dimethyl-2,5-diphenylsilole has a molecular weight of 262.43 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-2,5-diphenylsilole is sourced from PubChem (CID 11054501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).