C17H32O2 — CID 11054687
(1R,2R,4aS,8aS)-1-(3-hydroxypropyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 11054687) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (1R,2R,4aS,8aS)-1-(3-hydroxypropyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (1R,2R,4aS,8aS)-1-(3-hydroxypropyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 11054687 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (1R,2R,4aS,8aS)-1-(3-hydroxypropyl)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CCCO)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C17H32O2/c1-15(2)9-6-10-16(3)13(15)8-11-17(4,19)14(16)7-5-12-18/h13-14,18-19H,5-12H2,1-4H3/t13-,14+,16-,17+/m0/s1 |
| InChIKey | NFWFGTBPOBFNSB-HDEZJCGLSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |