C16H14F3NOS3 — CID 1105469
2,2,2-trifluoro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone (PubChem CID 1105469) has the molecular formula C16H14F3NOS3 and a molecular weight of 389.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
|---|---|
| PubChem CID | 1105469 |
| Molecular Formula | C16H14F3NOS3 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 2,2,2-trifluoro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
| SMILES | Cc1cc2c(cc1C)N(C(=O)C(F)(F)F)C(C)(C)c1ssc(=S)c1-2 |
| InChI | InChI=1S/C16H14F3NOS3/c1-7-5-9-10(6-8(7)2)20(14(21)16(17,18)19)15(3,4)12-11(9)13(22)24-23-12/h5-6H,1-4H3 |
| InChIKey | PSXSNDCBHDQKKY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|