C23H26N2O6 — CID 110547738
1-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione (PubChem CID 110547738) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110547738 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-ethoxyphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(N(C)CCO)C(=O)N(c3ccc(OC)cc3OC)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O6/c1-5-31-16-8-6-15(7-9-16)20-21(24(2)12-13-26)23(28)25(22(20)27)18-11-10-17(29-3)14-19(18)30-4/h6-11,14,26H,5,12-13H2,1-4H3 |
| InChIKey | QOHVQMQVODWWIX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|