C25H27ClN2O3 — CID 110547875
1-(3-chloro-4-methylphenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione (PubChem CID 110547875) has the molecular formula C25H27ClN2O3 and a molecular weight of 438.96 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110547875 |
| Molecular Formula | C25H27ClN2O3 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperidin-1-yl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(N3CCC(C)CC3)C(=O)N(c3ccc(C)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H27ClN2O3/c1-4-31-20-9-6-18(7-10-20)22-23(27-13-11-16(2)12-14-27)25(30)28(24(22)29)19-8-5-17(3)21(26)15-19/h5-10,15-16H,4,11-14H2,1-3H3 |
| InChIKey | XKOHKTXIMPJBRJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|