C29H28N2O3 — CID 110547946
3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2,4-dimethylphenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110547946) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2,4-dimethylphenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2,4-dimethylphenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110547946 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(2,4-dimethylphenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(N3CCCc4ccccc43)C(=O)N(c3ccc(C)cc3C)C2=O)cc1 |
| InChI | InChI=1S/C29H28N2O3/c1-4-34-23-14-12-22(13-15-23)26-27(30-17-7-9-21-8-5-6-10-25(21)30)29(33)31(28(26)32)24-16-11-19(2)18-20(24)3/h5-6,8,10-16,18H,4,7,9,17H2,1-3H3 |
| InChIKey | HSBQJOHQDPCJBG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|