C14H12N2O4 — CID 11054801
2,6-diethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 11054801) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2,6-diethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-diethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 11054801 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,6-diethylpyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CCn1c(=O)c2cc3c(=O)n(CC)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C14H12N2O4/c1-3-15-11(17)7-5-9-10(6-8(7)12(15)18)14(20)16(4-2)13(9)19/h5-6H,3-4H2,1-2H3 |
| InChIKey | SNZOALZDDAZGBX-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |