C15H18N2O3 — CID 11054873
(5S,6S)-4,5-dimethyl-3-(2-methylprop-2-enoyl)-6-phenyl-1,3,4-oxadiazinan-2-one (PubChem CID 11054873) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (5S,6S)-4,5-dimethyl-3-(2-methylprop-2-enoyl)-6-phenyl-1,3,4-oxadiazinan-2-one.
| Compound Name | (5S,6S)-4,5-dimethyl-3-(2-methylprop-2-enoyl)-6-phenyl-1,3,4-oxadiazinan-2-one |
|---|---|
| PubChem CID | 11054873 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (5S,6S)-4,5-dimethyl-3-(2-methylprop-2-enoyl)-6-phenyl-1,3,4-oxadiazinan-2-one |
| SMILES | C=C(C)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H](C)N1C |
| InChI | InChI=1S/C15H18N2O3/c1-10(2)14(18)17-15(19)20-13(11(3)16(17)4)12-8-6-5-7-9-12/h5-9,11,13H,1H2,2-4H3/t11-,13+/m0/s1 |
| InChIKey | HCHGXODEWXGCTJ-WCQYABFASA-N |
| XLogP | 2.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|