C18H31NO — CID 11054983
6-(dipropylamino)-3,3-dimethyl-2,4,5,6,7,8-hexahydronaphthalen-1-one (PubChem CID 11054983) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 6-(dipropylamino)-3,3-dimethyl-2,4,5,6,7,8-hexahydronaphthalen-1-one.
| Compound Name | 6-(dipropylamino)-3,3-dimethyl-2,4,5,6,7,8-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 11054983 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 6-(dipropylamino)-3,3-dimethyl-2,4,5,6,7,8-hexahydronaphthalen-1-one |
| SMILES | CCCN(CCC)C1CCC2=C(C1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C18H31NO/c1-5-9-19(10-6-2)15-7-8-16-14(11-15)12-18(3,4)13-17(16)20/h15H,5-13H2,1-4H3 |
| InChIKey | WBCABFRHFMFUII-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |