C15H22N2O3 — CID 11055005
ethyl (3S,4aS,5S,8aR)-5-cyano-3,5-dimethyl-6-oxo-2,3,4,4a,7,8-hexahydro-1H-isoquinoline-8a-carboxylate (PubChem CID 11055005) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (3S,4aS,5S,8aR)-5-cyano-3,5-dimethyl-6-oxo-2,3,4,4a,7,8-hexahydro-1H-isoquinoline-8a-carboxylate.
| Compound Name | ethyl (3S,4aS,5S,8aR)-5-cyano-3,5-dimethyl-6-oxo-2,3,4,4a,7,8-hexahydro-1H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 11055005 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethyl (3S,4aS,5S,8aR)-5-cyano-3,5-dimethyl-6-oxo-2,3,4,4a,7,8-hexahydro-1H-isoquinoline-8a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC(=O)[C@](C)(C#N)[C@@H]1C[C@H](C)NC2 |
| InChI | InChI=1S/C15H22N2O3/c1-4-20-13(19)15-6-5-12(18)14(3,8-16)11(15)7-10(2)17-9-15/h10-11,17H,4-7,9H2,1-3H3/t10-,11-,14+,15-/m0/s1 |
| InChIKey | QMTUCSHVFOXNHK-AZHAFVHUSA-N |
| XLogP | 1.43 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |