C25H20ClNO3S — CID 110550560
1-(5-chloro-2-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-phenylsulfanylpyrrole-2,5-dione (PubChem CID 110550560) has the molecular formula C25H20ClNO3S and a molecular weight of 449.96 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-phenylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-phenylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110550560 |
| Molecular Formula | C25H20ClNO3S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-phenylsulfanylpyrrole-2,5-dione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)C(Sc2ccccc2)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C25H20ClNO3S/c1-15-9-10-17(13-16(15)2)22-23(31-19-7-5-4-6-8-19)25(29)27(24(22)28)20-14-18(26)11-12-21(20)30-3/h4-14H,1-3H3 |
| InChIKey | LIOSLIOBNPVWLN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|