C21H20ClNO2S — CID 110550614
1-(4-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-ethylsulfanylpyrrole-2,5-dione (PubChem CID 110550614) has the molecular formula C21H20ClNO2S and a molecular weight of 385.92 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-ethylsulfanylpyrrole-2,5-dione.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-ethylsulfanylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110550614 |
| Molecular Formula | C21H20ClNO2S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-ethylsulfanylpyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccc(C)c(C)c2)C(=O)N(c2ccc(Cl)cc2C)C1=O |
| InChI | InChI=1S/C21H20ClNO2S/c1-5-26-19-18(15-7-6-12(2)13(3)10-15)20(24)23(21(19)25)17-9-8-16(22)11-14(17)4/h6-11H,5H2,1-4H3 |
| InChIKey | HJCXMYGVIQEXOS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|