About (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one
(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one (PubChem CID 11055220) has the molecular formula C16H32O2Si
and a molecular weight of 284.52 g/mol. Its IUPAC name is (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one.
Molecular Properties
| Compound Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one |
| PubChem CID | 11055220 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)CC |
| InChI | InChI=1S/C16H32O2Si/c1-10-12-14(16(6,7)13(17)11-2)18-19(8,9)15(3,4)5/h10,14H,1,11-12H2,2-9H3/t14-/m0/s1 |
| InChIKey | RRBWKUCJPXAHGK-AWEZNQCLSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one?
The IUPAC name of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one (CID 11055220) is (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one.
What is the SMILES notation for (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one?
The canonical SMILES for (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one is C=CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)CC.
What is the InChIKey of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one?
The InChIKey is RRBWKUCJPXAHGK-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H32O2Si/c1-10-12-14(16(6,7)13(17)11-2)18-19(8,9)15(3,4)5/h10,14H,1,11-12H2,2-9H3/t14-/m0/s1.
What are the key properties of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one?
(5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one has a molecular weight of 284.52 g/mol, XLogP of 4.96, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-7-en-3-one is sourced from PubChem (CID 11055220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).