About 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole
4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole (PubChem CID 11055255) has the molecular formula C8H10N6O4S
and a molecular weight of 286.27 g/mol. Its IUPAC name is 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole.
Molecular Properties
| Compound Name | 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole |
| PubChem CID | 11055255 |
| Molecular Formula | C8H10N6O4S |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole |
| SMILES | Cn1c([N+](=O)[O-])cnc1-c1nnc(S(C)(=O)=O)n1C |
| InChI | InChI=1S/C8H10N6O4S/c1-12-5(14(15)16)4-9-6(12)7-10-11-8(13(7)2)19(3,17)18/h4H,1-3H3 |
| InChIKey | XEGIVNZICGOFFK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 125.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole?
The IUPAC name of 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole (CID 11055255) is 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole.
What is the SMILES notation for 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole?
The canonical SMILES for 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole is Cn1c([N+](=O)[O-])cnc1-c1nnc(S(C)(=O)=O)n1C.
What is the InChIKey of 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole?
The InChIKey is XEGIVNZICGOFFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N6O4S/c1-12-5(14(15)16)4-9-6(12)7-10-11-8(13(7)2)19(3,17)18/h4H,1-3H3.
What are the key properties of 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole?
4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole has a molecular weight of 286.27 g/mol, XLogP of -0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(1-methyl-5-nitroimidazol-2-yl)-5-methylsulfonyl-1,2,4-triazole is sourced from PubChem (CID 11055255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).