C22H20N2O3S — CID 110552658
3-[benzyl(ethyl)amino]-1-(furan-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110552658) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-1-(furan-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-[benzyl(ethyl)amino]-1-(furan-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552658 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-1-(furan-2-ylmethyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCN(Cc1ccccc1)C1=C(c2cccs2)C(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C22H20N2O3S/c1-2-23(14-16-8-4-3-5-9-16)20-19(18-11-7-13-28-18)21(25)24(22(20)26)15-17-10-6-12-27-17/h3-13H,2,14-15H2,1H3 |
| InChIKey | YWATWBFQRCBISQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|