C19H18N2O3S — CID 110554691
1-(3-methylphenyl)-3-morpholin-4-yl-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554691) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-morpholin-4-yl-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3-methylphenyl)-3-morpholin-4-yl-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554691 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 1-(3-methylphenyl)-3-morpholin-4-yl-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C(c3cccs3)=C(N3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C19H18N2O3S/c1-13-4-2-5-14(12-13)21-18(22)16(15-6-3-11-25-15)17(19(21)23)20-7-9-24-10-8-20/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | KTRZWONKEWJJDX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|