C22H16ClNO4S2 — CID 110554745
3-(4-chlorophenyl)sulfanyl-1-(2,4-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110554745) has the molecular formula C22H16ClNO4S2 and a molecular weight of 457.96 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-1-(2,4-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-1-(2,4-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110554745 |
| Molecular Formula | C22H16ClNO4S2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-1-(2,4-dimethoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(Sc3ccc(Cl)cc3)=C(c3cccs3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H16ClNO4S2/c1-27-14-7-10-16(17(12-14)28-2)24-21(25)19(18-4-3-11-29-18)20(22(24)26)30-15-8-5-13(23)6-9-15/h3-12H,1-2H3 |
| InChIKey | SHGUJRBYPMERIX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|