C23H17F3N2O2S — CID 110555436
3-(N-ethylanilino)-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110555436) has the molecular formula C23H17F3N2O2S and a molecular weight of 442.46 g/mol. Its IUPAC name is 3-(N-ethylanilino)-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(N-ethylanilino)-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555436 |
| Molecular Formula | C23H17F3N2O2S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-(N-ethylanilino)-4-thiophen-2-yl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | CCN(C1=C(c2cccs2)C(=O)N(c2ccc(C(F)(F)F)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C23H17F3N2O2S/c1-2-27(16-7-4-3-5-8-16)20-19(18-9-6-14-31-18)21(29)28(22(20)30)17-12-10-15(11-13-17)23(24,25)26/h3-14H,2H2,1H3 |
| InChIKey | UUZDNTKUOQFRFH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|