C17H28O4 — CID 11055555
4-(2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl)butanoic acid (PubChem CID 11055555) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-(2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl)butanoic acid.
| Compound Name | 4-(2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl)butanoic acid |
|---|---|
| PubChem CID | 11055555 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-(2,2,6,6,8-pentamethyl-1,3-dioxaspiro[4.5]dec-7-en-7-yl)butanoic acid |
| SMILES | CC1=C(CCCC(=O)O)C(C)(C)C2(CC1)COC(C)(C)O2 |
| InChI | InChI=1S/C17H28O4/c1-12-9-10-17(11-20-16(4,5)21-17)15(2,3)13(12)7-6-8-14(18)19/h6-11H2,1-5H3,(H,18,19) |
| InChIKey | GYVGVOWQZQSEAL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|