C18H24N4 — CID 11055562
(2S,4R,6S,8R)-3,7-ditert-butyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarbonitrile (PubChem CID 11055562) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is (2S,4R,6S,8R)-3,7-ditert-butyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarbonitrile.
| Compound Name | (2S,4R,6S,8R)-3,7-ditert-butyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 11055562 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (2S,4R,6S,8R)-3,7-ditert-butyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarbonitrile |
| SMILES | CC(C)(C)C1[C@@H]2[C@H]1C1(C#N)N=NC2(C#N)[C@H]2C(C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C18H24N4/c1-15(2,3)9-11-12(9)18(8-20)14-10(16(4,5)6)13(14)17(11,7-19)21-22-18/h9-14H,1-6H3/t9?,10?,11-,12+,13+,14-,17?,18? |
| InChIKey | HGHLPMAJEQIKAO-VZZXYHHISA-N |
| XLogP | 3.81 |
| TPSA | 72.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |