C18H36N2O — CID 11055564
(E,2S,4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4,6-trimethylnonan-1-imine (PubChem CID 11055564) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is (E,2S,4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4,6-trimethylnonan-1-imine.
| Compound Name | (E,2S,4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4,6-trimethylnonan-1-imine |
|---|---|
| PubChem CID | 11055564 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | (E,2S,4S,6S)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2,4,6-trimethylnonan-1-imine |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)/C=N/N1CCC[C@H]1COC |
| InChI | InChI=1S/C18H36N2O/c1-6-8-15(2)11-16(3)12-17(4)13-19-20-10-7-9-18(20)14-21-5/h13,15-18H,6-12,14H2,1-5H3/b19-13+/t15-,16-,17-,18-/m0/s1 |
| InChIKey | LESBGBZGNREXLH-WMIBTEETSA-N |
| XLogP | 4.57 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|