C18H23NO5S — CID 110556466
3-(2-hydroxyethylsulfanyl)-4-(4-methoxyphenyl)-1-(2-propan-2-yloxyethyl)pyrrole-2,5-dione (PubChem CID 110556466) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-4-(4-methoxyphenyl)-1-(2-propan-2-yloxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-4-(4-methoxyphenyl)-1-(2-propan-2-yloxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556466 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-4-(4-methoxyphenyl)-1-(2-propan-2-yloxyethyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(SCCO)C(=O)N(CCOC(C)C)C2=O)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-12(2)24-10-8-19-17(21)15(16(18(19)22)25-11-9-20)13-4-6-14(23-3)7-5-13/h4-7,12,20H,8-11H2,1-3H3 |
| InChIKey | BGDHDILLRSRTAS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|