C26H32N4O3 — CID 110556763
1-hexyl-3-(4-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110556763) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-hexyl-3-(4-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-hexyl-3-(4-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556763 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-hexyl-3-(4-methoxyphenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccc(OC)cc2)=C(N2CCN(c3ccccn3)CC2)C1=O |
| InChI | InChI=1S/C26H32N4O3/c1-3-4-5-8-15-30-25(31)23(20-10-12-21(33-2)13-11-20)24(26(30)32)29-18-16-28(17-19-29)22-9-6-7-14-27-22/h6-7,9-14H,3-5,8,15-19H2,1-2H3 |
| InChIKey | FLKSQSVMQZXGGQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|