C20H30O2 — CID 11055776
(3S,4E,16E,18S)-icosa-4,16-dien-1,19-diyne-3,18-diol (PubChem CID 11055776) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (3S,4E,16E,18S)-icosa-4,16-dien-1,19-diyne-3,18-diol.
| Compound Name | (3S,4E,16E,18S)-icosa-4,16-dien-1,19-diyne-3,18-diol |
|---|---|
| PubChem CID | 11055776 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3S,4E,16E,18S)-icosa-4,16-dien-1,19-diyne-3,18-diol |
| SMILES | C#C[C@@H](O)/C=C/CCCCCCCCCC/C=C/[C@H](O)C#C |
| InChI | InChI=1S/C20H30O2/c1-3-19(21)17-15-13-11-9-7-5-6-8-10-12-14-16-18-20(22)4-2/h1-2,15-22H,5-14H2/b17-15+,18-16+/t19-,20-/m1/s1 |
| InChIKey | JVVMUHJDTNMVHZ-AZBDOTAUSA-N |
| XLogP | 3.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|