C14H20F3NOSi — CID 11055804
2,2,2-trifluoro-N-[(2R,3E,5E)-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynyl]acetamide (PubChem CID 11055804) has the molecular formula C14H20F3NOSi and a molecular weight of 303.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,3E,5E)-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,3E,5E)-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynyl]acetamide |
|---|---|
| PubChem CID | 11055804 |
| Molecular Formula | C14H20F3NOSi |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,3E,5E)-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynyl]acetamide |
| SMILES | C[C@H](/C=C/C=C/C#C[Si](C)(C)C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NOSi/c1-12(11-18-13(19)14(15,16)17)9-7-5-6-8-10-20(2,3)4/h5-7,9,12H,11H2,1-4H3,(H,18,19)/b6-5+,9-7+/t12-/m1/s1 |
| InChIKey | OVSUVMLHLGQRJX-CNBHAXKCSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|