C25H18F2N2O3 — CID 110558225
1-(2,4-difluorophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 110558225) has the molecular formula C25H18F2N2O3 and a molecular weight of 432.43 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558225 |
| Molecular Formula | C25H18F2N2O3 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2,3-dihydroindol-1-yl)-4-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(N3CCc4ccccc43)C(=O)N(c3ccc(F)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C25H18F2N2O3/c1-32-18-9-6-16(7-10-18)22-23(28-13-12-15-4-2-3-5-20(15)28)25(31)29(24(22)30)21-11-8-17(26)14-19(21)27/h2-11,14H,12-13H2,1H3 |
| InChIKey | RNILCMJFEAONRS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|