C11H13BrO5 — CID 11055864
3-bromo-4-(1,3-dioxolan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 11055864) has the molecular formula C11H13BrO5 and a molecular weight of 305.12 g/mol. Its IUPAC name is 3-bromo-4-(1,3-dioxolan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 3-bromo-4-(1,3-dioxolan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11055864 |
| Molecular Formula | C11H13BrO5 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-bromo-4-(1,3-dioxolan-2-yl)-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C=C(C2OCCO2)C(Br)=CC1=O |
| InChI | InChI=1S/C11H13BrO5/c1-14-11(15-2)6-7(8(12)5-9(11)13)10-16-3-4-17-10/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | UVCLMKOKBHMEOC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|