C26H23N3O2 — CID 110558734
3-(2,3-dihydroindol-1-yl)-1-[4-(dimethylamino)phenyl]-4-phenylpyrrole-2,5-dione (PubChem CID 110558734) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-1-[4-(dimethylamino)phenyl]-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-1-[4-(dimethylamino)phenyl]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558734 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-1-[4-(dimethylamino)phenyl]-4-phenylpyrrole-2,5-dione |
| SMILES | CN(C)c1ccc(N2C(=O)C(c3ccccc3)=C(N3CCc4ccccc43)C2=O)cc1 |
| InChI | InChI=1S/C26H23N3O2/c1-27(2)20-12-14-21(15-13-20)29-25(30)23(19-9-4-3-5-10-19)24(26(29)31)28-17-16-18-8-6-7-11-22(18)28/h3-15H,16-17H2,1-2H3 |
| InChIKey | QDBNCSZRBFSLBV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|