C26H24N4O2 — CID 110559226
3-phenyl-4-(4-phenylpiperazin-1-yl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione (PubChem CID 110559226) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-phenyl-4-(4-phenylpiperazin-1-yl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-phenyl-4-(4-phenylpiperazin-1-yl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110559226 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-phenyl-4-(4-phenylpiperazin-1-yl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(N2CCN(c3ccccc3)CC2)C(=O)N1Cc1ccncc1 |
| InChI | InChI=1S/C26H24N4O2/c31-25-23(21-7-3-1-4-8-21)24(26(32)30(25)19-20-11-13-27-14-12-20)29-17-15-28(16-18-29)22-9-5-2-6-10-22/h1-14H,15-19H2 |
| InChIKey | AVFDQWLTMABHRK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|