About (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide
(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide (PubChem CID 11055967) has the molecular formula C11H20INO
and a molecular weight of 309.19 g/mol. Its IUPAC name is (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide.
Molecular Properties
| Compound Name | (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide |
| PubChem CID | 11055967 |
| Molecular Formula | C11H20INO |
| Molecular Weight | 309.19 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide |
| SMILES | CCOC1=C/C(=[NH+]\C)CC(C)(C)C1.[I-] |
| InChI | InChI=1S/C11H19NO.HI/c1-5-13-10-6-9(12-4)7-11(2,3)8-10;/h6H,5,7-8H2,1-4H3;1H/b12-9+; |
| InChIKey | OUUYFEXAQUNYKX-NBYYMMLRSA-N |
| XLogP | -2.12 |
| TPSA | 23.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.19 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide?
The IUPAC name of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide (CID 11055967) is (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide.
What is the SMILES notation for (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide?
The canonical SMILES for (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide is CCOC1=C/C(=[NH+]\C)CC(C)(C)C1.[I-].
What is the InChIKey of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide?
The InChIKey is OUUYFEXAQUNYKX-NBYYMMLRSA-N. The full InChI is InChI=1S/C11H19NO.HI/c1-5-13-10-6-9(12-4)7-11(2,3)8-10;/h6H,5,7-8H2,1-4H3;1H/b12-9+;.
What are the key properties of (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide?
(3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide has a molecular weight of 309.19 g/mol, XLogP of -2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-5,5-dimethylcyclohex-2-en-1-ylidene)-methylazanium iodide is sourced from PubChem (CID 11055967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).