C18H12O4 — CID 11056
2,5-dihydroxy-3,6-diphenylcyclohexa-2,5-diene-1,4-dione (PubChem CID 11056) has the molecular formula C18H12O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2,5-dihydroxy-3,6-diphenylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3,6-diphenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11056 |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2,5-dihydroxy-3,6-diphenylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(O)=C(c2ccccc2)C(=O)C(O)=C1c1ccccc1 |
| InChI | InChI=1S/C18H12O4/c19-15-13(11-7-3-1-4-8-11)16(20)18(22)14(17(15)21)12-9-5-2-6-10-12/h1-10,19,22H |
| InChIKey | HZKFHDXTSAYOSN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|