C23H32N4O4 — CID 110560193
3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione (PubChem CID 110560193) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560193 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(3-morpholin-4-ylpropyl)-4-phenylpyrrole-2,5-dione |
| SMILES | O=C1C(c2ccccc2)=C(N2CCN(CCO)CC2)C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C23H32N4O4/c28-16-13-25-9-11-26(12-10-25)21-20(19-5-2-1-3-6-19)22(29)27(23(21)30)8-4-7-24-14-17-31-18-15-24/h1-3,5-6,28H,4,7-18H2 |
| InChIKey | NSPUOUNYIQLMMZ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|