C20H19NO2S — CID 110560462
1-(3,5-dimethylphenyl)-3-ethylsulfanyl-4-phenylpyrrole-2,5-dione (PubChem CID 110560462) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-ethylsulfanyl-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-ethylsulfanyl-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560462 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-ethylsulfanyl-4-phenylpyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccccc2)C(=O)N(c2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C20H19NO2S/c1-4-24-18-17(15-8-6-5-7-9-15)19(22)21(20(18)23)16-11-13(2)10-14(3)12-16/h5-12H,4H2,1-3H3 |
| InChIKey | GAZHBFPFXMEVCS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|