About 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one
2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one (PubChem CID 1105605) has the molecular formula C16H12BrNO4
and a molecular weight of 362.18 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one |
| PubChem CID | 1105605 |
| Molecular Formula | C16H12BrNO4 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one |
| SMILES | COc1cc2nc(-c3ccc(Br)cc3)oc(=O)c2cc1OC |
| InChI | InChI=1S/C16H12BrNO4/c1-20-13-7-11-12(8-14(13)21-2)18-15(22-16(11)19)9-3-5-10(17)6-4-9/h3-8H,1-2H3 |
| InChIKey | CQOVFVPOPHUBGL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one?
The IUPAC name of 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one (CID 1105605) is 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one?
The canonical SMILES for 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one is COc1cc2nc(-c3ccc(Br)cc3)oc(=O)c2cc1OC.
What is the InChIKey of 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one?
The InChIKey is CQOVFVPOPHUBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrNO4/c1-20-13-7-11-12(8-14(13)21-2)18-15(22-16(11)19)9-3-5-10(17)6-4-9/h3-8H,1-2H3.
What are the key properties of 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one?
2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one has a molecular weight of 362.18 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-6,7-dimethoxy-3,1-benzoxazin-4-one is sourced from PubChem (CID 1105605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).