C24H21N3O4S — CID 110561205
4-[3-(N-ethylanilino)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide (PubChem CID 110561205) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 4-[3-(N-ethylanilino)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(N-ethylanilino)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110561205 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-[3-(N-ethylanilino)-2,5-dioxo-4-phenylpyrrol-1-yl]benzenesulfonamide |
| SMILES | CCN(C1=C(c2ccccc2)C(=O)N(c2ccc(S(N)(=O)=O)cc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4S/c1-2-26(18-11-7-4-8-12-18)22-21(17-9-5-3-6-10-17)23(28)27(24(22)29)19-13-15-20(16-14-19)32(25,30)31/h3-16H,2H2,1H3,(H2,25,30,31) |
| InChIKey | GKYQJOPFHQVIIP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|