C24H26N2O5 — CID 110561479
1-(3,4-dimethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)-4-phenylpyrrole-2,5-dione (PubChem CID 110561479) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110561479 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)-4-phenylpyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(c3ccccc3)=C(N3CC(C)OC(C)C3)C2=O)cc1OC |
| InChI | InChI=1S/C24H26N2O5/c1-15-13-25(14-16(2)31-15)22-21(17-8-6-5-7-9-17)23(27)26(24(22)28)18-10-11-19(29-3)20(12-18)30-4/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | CLPIBMQVXHXOFJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|