C27H24N2O4 — CID 110561758
3-[benzyl(ethyl)amino]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione (PubChem CID 110561758) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione.
| Compound Name | 3-[benzyl(ethyl)amino]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110561758 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-phenylpyrrole-2,5-dione |
| SMILES | CCN(Cc1ccccc1)C1=C(c2ccccc2)C(=O)N(c2ccc3c(c2)OCCO3)C1=O |
| InChI | InChI=1S/C27H24N2O4/c1-2-28(18-19-9-5-3-6-10-19)25-24(20-11-7-4-8-12-20)26(30)29(27(25)31)21-13-14-22-23(17-21)33-16-15-32-22/h3-14,17H,2,15-16,18H2,1H3 |
| InChIKey | HGBPXEQMPOMZBR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|