About (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one
(17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one (PubChem CID 11056200) has the molecular formula C16H28O2S2
and a molecular weight of 316.53 g/mol. Its IUPAC name is (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one.
Molecular Properties
| Compound Name | (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one |
| PubChem CID | 11056200 |
| Molecular Formula | C16H28O2S2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one |
| SMILES | C[C@@H]1CC2(CCCCCCCCC(=O)O1)SCCCS2 |
| InChI | InChI=1S/C16H28O2S2/c1-14-13-16(19-11-8-12-20-16)10-7-5-3-2-4-6-9-15(17)18-14/h14H,2-13H2,1H3/t14-/m1/s1 |
| InChIKey | LHHCDOAFGOIMLC-CQSZACIVSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one?
The IUPAC name of (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one (CID 11056200) is (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one.
What is the SMILES notation for (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one?
The canonical SMILES for (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one is C[C@@H]1CC2(CCCCCCCCC(=O)O1)SCCCS2.
What is the InChIKey of (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one?
The InChIKey is LHHCDOAFGOIMLC-CQSZACIVSA-N. The full InChI is InChI=1S/C16H28O2S2/c1-14-13-16(19-11-8-12-20-16)10-7-5-3-2-4-6-9-15(17)18-14/h14H,2-13H2,1H3/t14-/m1/s1.
What are the key properties of (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one?
(17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one has a molecular weight of 316.53 g/mol, XLogP of 5.01, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (17R)-17-methyl-16-oxa-1,5-dithiaspiro[5.12]octadecan-15-one is sourced from PubChem (CID 11056200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).