C24H16F3NO2S — CID 110562072
3-benzylsulfanyl-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 110562072) has the molecular formula C24H16F3NO2S and a molecular weight of 439.46 g/mol. Its IUPAC name is 3-benzylsulfanyl-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110562072 |
| Molecular Formula | C24H16F3NO2S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 3-benzylsulfanyl-4-phenyl-1-[4-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(SCc2ccccc2)=C(c2ccccc2)C(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H16F3NO2S/c25-24(26,27)18-11-13-19(14-12-18)28-22(29)20(17-9-5-2-6-10-17)21(23(28)30)31-15-16-7-3-1-4-8-16/h1-14H,15H2 |
| InChIKey | DGGREHHLBPFFFE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|